About 2-hexoxycyclohexa-2,5-diene-1,4-diimine
2-hexoxycyclohexa-2,5-diene-1,4-diimine (PubChem CID 142593393) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-hexoxycyclohexa-2,5-diene-1,4-diimine.
Molecular Properties
| Compound Name | 2-hexoxycyclohexa-2,5-diene-1,4-diimine |
| PubChem CID | 142593393 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-hexoxycyclohexa-2,5-diene-1,4-diimine |
| SMILES | [H]/N=C1\C=C/C(=N\[H])C(OCCCCCC)=C1 |
| InChI | InChI=1S/C12H18N2O/c1-2-3-4-5-8-15-12-9-10(13)6-7-11(12)14/h6-7,9,13-14H,2-5,8H2,1H3/b13-10+,14-11+ |
| InChIKey | XQEAMQAIQMUJCI-IFQMDVHZSA-N |
| XLogP | 3.08 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hexoxycyclohexa-2,5-diene-1,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexoxycyclohexa-2,5-diene-1,4-diimine?
The IUPAC name of 2-hexoxycyclohexa-2,5-diene-1,4-diimine (CID 142593393) is 2-hexoxycyclohexa-2,5-diene-1,4-diimine.
What is the SMILES notation for 2-hexoxycyclohexa-2,5-diene-1,4-diimine?
The canonical SMILES for 2-hexoxycyclohexa-2,5-diene-1,4-diimine is [H]/N=C1\C=C/C(=N\[H])C(OCCCCCC)=C1.
What is the InChIKey of 2-hexoxycyclohexa-2,5-diene-1,4-diimine?
The InChIKey is XQEAMQAIQMUJCI-IFQMDVHZSA-N. The full InChI is InChI=1S/C12H18N2O/c1-2-3-4-5-8-15-12-9-10(13)6-7-11(12)14/h6-7,9,13-14H,2-5,8H2,1H3/b13-10+,14-11+.
What are the key properties of 2-hexoxycyclohexa-2,5-diene-1,4-diimine?
2-hexoxycyclohexa-2,5-diene-1,4-diimine has a molecular weight of 206.29 g/mol, XLogP of 3.08, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexoxycyclohexa-2,5-diene-1,4-diimine is sourced from PubChem (CID 142593393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).