About 4-(3-methyl-5-piperidin-4-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol
4-(3-methyl-5-piperidin-4-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol (PubChem CID 142594116) has the molecular formula C21H22N4O
and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-(3-methyl-5-piperidin-4-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol.
Molecular Properties
| Compound Name | 4-(3-methyl-5-piperidin-4-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol |
| PubChem CID | 142594116 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 4-(3-methyl-5-piperidin-4-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol |
| SMILES | Cc1c(-c2ccnc3[nH]cc(O)c23)[nH]c2ccc(C3CCNCC3)cc12 |
| InChI | InChI=1S/C21H22N4O/c1-12-16-10-14(13-4-7-22-8-5-13)2-3-17(16)25-20(12)15-6-9-23-21-19(15)18(26)11-24-21/h2-3,6,9-11,13,22,25-26H,4-5,7-8H2,1H3,(H,23,24) |
| InChIKey | UJCQPJSFAXQJOU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-methyl-5-piperidin-4-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methyl-5-piperidin-4-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol?
The IUPAC name of 4-(3-methyl-5-piperidin-4-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol (CID 142594116) is 4-(3-methyl-5-piperidin-4-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol.
What is the SMILES notation for 4-(3-methyl-5-piperidin-4-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol?
The canonical SMILES for 4-(3-methyl-5-piperidin-4-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol is Cc1c(-c2ccnc3[nH]cc(O)c23)[nH]c2ccc(C3CCNCC3)cc12.
What is the InChIKey of 4-(3-methyl-5-piperidin-4-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol?
The InChIKey is UJCQPJSFAXQJOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O/c1-12-16-10-14(13-4-7-22-8-5-13)2-3-17(16)25-20(12)15-6-9-23-21-19(15)18(26)11-24-21/h2-3,6,9-11,13,22,25-26H,4-5,7-8H2,1H3,(H,23,24).
What are the key properties of 4-(3-methyl-5-piperidin-4-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol?
4-(3-methyl-5-piperidin-4-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol has a molecular weight of 346.43 g/mol, XLogP of 4.19, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methyl-5-piperidin-4-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol is sourced from PubChem (CID 142594116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).