About 4-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol
4-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol (PubChem CID 142594614) has the molecular formula C23H26N4O
and a molecular weight of 374.49 g/mol. Its IUPAC name is 4-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol.
Molecular Properties
| Compound Name | 4-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol |
| PubChem CID | 142594614 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 4-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol |
| SMILES | CC(C)c1c(-c2ccnc3[nH]cc(O)c23)[nH]c2ccc(C3CCNCC3)cc12 |
| InChI | InChI=1S/C23H26N4O/c1-13(2)20-17-11-15(14-5-8-24-9-6-14)3-4-18(17)27-22(20)16-7-10-25-23-21(16)19(28)12-26-23/h3-4,7,10-14,24,27-28H,5-6,8-9H2,1-2H3,(H,25,26) |
| InChIKey | XRXGLBZZCNMKMC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol?
The IUPAC name of 4-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol (CID 142594614) is 4-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol.
What is the SMILES notation for 4-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol?
The canonical SMILES for 4-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol is CC(C)c1c(-c2ccnc3[nH]cc(O)c23)[nH]c2ccc(C3CCNCC3)cc12.
What is the InChIKey of 4-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol?
The InChIKey is XRXGLBZZCNMKMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N4O/c1-13(2)20-17-11-15(14-5-8-24-9-6-14)3-4-18(17)27-22(20)16-7-10-25-23-21(16)19(28)12-26-23/h3-4,7,10-14,24,27-28H,5-6,8-9H2,1-2H3,(H,25,26).
What are the key properties of 4-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol?
4-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol has a molecular weight of 374.49 g/mol, XLogP of 5.01, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)-1H-pyrrolo[2,3-b]pyridin-3-ol is sourced from PubChem (CID 142594614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).