C25H27F3N8O2 — CID 142595296
2-[4-[7-[3-amino-2-methanimidoyl-6-(trifluoromethyl)phenyl]-2-methoxy-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile (PubChem CID 142595296) has the molecular formula C25H27F3N8O2 and a molecular weight of 528.54 g/mol. Its IUPAC name is 2-[4-[7-[3-amino-2-methanimidoyl-6-(trifluoromethyl)phenyl]-2-methoxy-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile.
| Compound Name | 2-[4-[7-[3-amino-2-methanimidoyl-6-(trifluoromethyl)phenyl]-2-methoxy-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 142595296 |
| Molecular Formula | C25H27F3N8O2 |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 2-[4-[7-[3-amino-2-methanimidoyl-6-(trifluoromethyl)phenyl]-2-methoxy-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
| SMILES | [H]/N=C/c1c(N)ccc(C(F)(F)F)c1N1CCc2c(nc(OC)nc2N2CCN(C(=O)C=C)C(CC#N)C2)C1 |
| InChI | InChI=1S/C25H27F3N8O2/c1-3-21(37)36-11-10-35(13-15(36)6-8-29)23-16-7-9-34(14-20(16)32-24(33-23)38-2)22-17(12-30)19(31)5-4-18(22)25(26,27)28/h3-5,12,15,30H,1,6-7,9-11,13-14,31H2,2H3/b30-12+ |
| InChIKey | XEVCPWUDQPSPRN-PNQUVVCRSA-N |
| XLogP | 2.76 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|