C28H39FN8O2S — CID 142595308
[3-[2-[2-(diethylamino)ethoxy]-4-(4-prop-2-enoylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-2-methanimidoyl-4-methylanilino] thiohypofluorite (PubChem CID 142595308) has the molecular formula C28H39FN8O2S and a molecular weight of 570.74 g/mol. Its IUPAC name is [3-[2-[2-(diethylamino)ethoxy]-4-(4-prop-2-enoylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-2-methanimidoyl-4-methylanilino] thiohypofluorite.
| Compound Name | [3-[2-[2-(diethylamino)ethoxy]-4-(4-prop-2-enoylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-2-methanimidoyl-4-methylanilino] thiohypofluorite |
|---|---|
| PubChem CID | 142595308 |
| Molecular Formula | C28H39FN8O2S |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | [3-[2-[2-(diethylamino)ethoxy]-4-(4-prop-2-enoylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-2-methanimidoyl-4-methylanilino] thiohypofluorite |
| SMILES | [H]/N=C/c1c(NSF)ccc(C)c1N1CCc2c(nc(OCCN(CC)CC)nc2N2CCN(C(=O)C=C)CC2)C1 |
| InChI | InChI=1S/C28H39FN8O2S/c1-5-25(38)35-12-14-36(15-13-35)27-21-10-11-37(26-20(4)8-9-23(33-40-29)22(26)18-30)19-24(21)31-28(32-27)39-17-16-34(6-2)7-3/h5,8-9,18,30,33H,1,6-7,10-17,19H2,2-4H3/b30-18+ |
| InChIKey | LHVWQDMZEXWHOC-UXHLAJHPSA-N |
| XLogP | 3.85 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|