About 2,2-difluoro-3-[4-(4-methylpiperazin-1-yl)butoxy]-N-propan-2-ylpropan-1-amine;molecular hydrogen
2,2-difluoro-3-[4-(4-methylpiperazin-1-yl)butoxy]-N-propan-2-ylpropan-1-amine;molecular hydrogen (PubChem CID 142596972) has the molecular formula C15H33F2N3O
and a molecular weight of 309.44 g/mol. Its IUPAC name is 2,2-difluoro-3-[4-(4-methylpiperazin-1-yl)butoxy]-N-propan-2-ylpropan-1-amine;molecular hydrogen.
Molecular Properties
| Compound Name | 2,2-difluoro-3-[4-(4-methylpiperazin-1-yl)butoxy]-N-propan-2-ylpropan-1-amine;molecular hydrogen |
| PubChem CID | 142596972 |
| Molecular Formula | C15H33F2N3O |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.26 |
| IUPAC Name | 2,2-difluoro-3-[4-(4-methylpiperazin-1-yl)butoxy]-N-propan-2-ylpropan-1-amine;molecular hydrogen |
| SMILES | CC(C)NCC(F)(F)COCCCCN1CCN(C)CC1.[H][H] |
| InChI | InChI=1S/C15H31F2N3O.H2/c1-14(2)18-12-15(16,17)13-21-11-5-4-6-20-9-7-19(3)8-10-20;/h14,18H,4-13H2,1-3H3;1H |
| InChIKey | VIBJJZWIAJDNIH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoro-3-[4-(4-methylpiperazin-1-yl)butoxy]-N-propan-2-ylpropan-1-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-3-[4-(4-methylpiperazin-1-yl)butoxy]-N-propan-2-ylpropan-1-amine;molecular hydrogen?
The IUPAC name of 2,2-difluoro-3-[4-(4-methylpiperazin-1-yl)butoxy]-N-propan-2-ylpropan-1-amine;molecular hydrogen (CID 142596972) is 2,2-difluoro-3-[4-(4-methylpiperazin-1-yl)butoxy]-N-propan-2-ylpropan-1-amine;molecular hydrogen.
What is the SMILES notation for 2,2-difluoro-3-[4-(4-methylpiperazin-1-yl)butoxy]-N-propan-2-ylpropan-1-amine;molecular hydrogen?
The canonical SMILES for 2,2-difluoro-3-[4-(4-methylpiperazin-1-yl)butoxy]-N-propan-2-ylpropan-1-amine;molecular hydrogen is CC(C)NCC(F)(F)COCCCCN1CCN(C)CC1.[H][H].
What is the InChIKey of 2,2-difluoro-3-[4-(4-methylpiperazin-1-yl)butoxy]-N-propan-2-ylpropan-1-amine;molecular hydrogen?
The InChIKey is VIBJJZWIAJDNIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31F2N3O.H2/c1-14(2)18-12-15(16,17)13-21-11-5-4-6-20-9-7-19(3)8-10-20;/h14,18H,4-13H2,1-3H3;1H.
What are the key properties of 2,2-difluoro-3-[4-(4-methylpiperazin-1-yl)butoxy]-N-propan-2-ylpropan-1-amine;molecular hydrogen?
2,2-difluoro-3-[4-(4-methylpiperazin-1-yl)butoxy]-N-propan-2-ylpropan-1-amine;molecular hydrogen has a molecular weight of 309.44 g/mol, XLogP of 1.91, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-3-[4-(4-methylpiperazin-1-yl)butoxy]-N-propan-2-ylpropan-1-amine;molecular hydrogen is sourced from PubChem (CID 142596972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).