About 4-bromo-2-methyl-3H-isoindol-1-one;6-bromo-2-methyl-3H-isoindol-1-one;ethane
4-bromo-2-methyl-3H-isoindol-1-one;6-bromo-2-methyl-3H-isoindol-1-one;ethane (PubChem CID 142597111) has the molecular formula C22H28Br2N2O2
and a molecular weight of 512.29 g/mol. Its IUPAC name is 4-bromo-2-methyl-3H-isoindol-1-one;6-bromo-2-methyl-3H-isoindol-1-one;ethane.
Molecular Properties
| Compound Name | 4-bromo-2-methyl-3H-isoindol-1-one;6-bromo-2-methyl-3H-isoindol-1-one;ethane |
| PubChem CID | 142597111 |
| Molecular Formula | C22H28Br2N2O2 |
| Molecular Weight | 512.29 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | 4-bromo-2-methyl-3H-isoindol-1-one;6-bromo-2-methyl-3H-isoindol-1-one;ethane |
| SMILES | CC.CC.CN1Cc2c(Br)cccc2C1=O.CN1Cc2ccc(Br)cc2C1=O |
| InChI | InChI=1S/2C9H8BrNO.2C2H6/c1-11-5-6-2-3-7(10)4-8(6)9(11)12;1-11-5-7-6(9(11)12)3-2-4-8(7)10;2*1-2/h2*2-4H,5H2,1H3;2*1-2H3 |
| InChIKey | YCOIRWINWRHIMI-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.29 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-2-methyl-3H-isoindol-1-one;6-bromo-2-methyl-3H-isoindol-1-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-methyl-3H-isoindol-1-one;6-bromo-2-methyl-3H-isoindol-1-one;ethane?
The IUPAC name of 4-bromo-2-methyl-3H-isoindol-1-one;6-bromo-2-methyl-3H-isoindol-1-one;ethane (CID 142597111) is 4-bromo-2-methyl-3H-isoindol-1-one;6-bromo-2-methyl-3H-isoindol-1-one;ethane.
What is the SMILES notation for 4-bromo-2-methyl-3H-isoindol-1-one;6-bromo-2-methyl-3H-isoindol-1-one;ethane?
The canonical SMILES for 4-bromo-2-methyl-3H-isoindol-1-one;6-bromo-2-methyl-3H-isoindol-1-one;ethane is CC.CC.CN1Cc2c(Br)cccc2C1=O.CN1Cc2ccc(Br)cc2C1=O.
What is the InChIKey of 4-bromo-2-methyl-3H-isoindol-1-one;6-bromo-2-methyl-3H-isoindol-1-one;ethane?
The InChIKey is YCOIRWINWRHIMI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H8BrNO.2C2H6/c1-11-5-6-2-3-7(10)4-8(6)9(11)12;1-11-5-7-6(9(11)12)3-2-4-8(7)10;2*1-2/h2*2-4H,5H2,1H3;2*1-2H3.
What are the key properties of 4-bromo-2-methyl-3H-isoindol-1-one;6-bromo-2-methyl-3H-isoindol-1-one;ethane?
4-bromo-2-methyl-3H-isoindol-1-one;6-bromo-2-methyl-3H-isoindol-1-one;ethane has a molecular weight of 512.29 g/mol, XLogP of 6.12, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-methyl-3H-isoindol-1-one;6-bromo-2-methyl-3H-isoindol-1-one;ethane is sourced from PubChem (CID 142597111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).