C26H34N4O3S2 — CID 142597124
(2S,4R)-1-[(2S)-2-(3,5-dimethyl-2H-1,3-thiazol-2-yl)-3-methylbutanoyl]-4-hydroxy-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 142597124) has the molecular formula C26H34N4O3S2 and a molecular weight of 514.72 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-2-(3,5-dimethyl-2H-1,3-thiazol-2-yl)-3-methylbutanoyl]-4-hydroxy-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(2S)-2-(3,5-dimethyl-2H-1,3-thiazol-2-yl)-3-methylbutanoyl]-4-hydroxy-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 142597124 |
| Molecular Formula | C26H34N4O3S2 |
| Molecular Weight | 514.72 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | (2S,4R)-1-[(2S)-2-(3,5-dimethyl-2H-1,3-thiazol-2-yl)-3-methylbutanoyl]-4-hydroxy-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | CC1=CN(C)C([C@H](C(=O)N2C[C@H](O)C[C@H]2C(=O)NCc2ccc(-c3scnc3C)cc2)C(C)C)S1 |
| InChI | InChI=1S/C26H34N4O3S2/c1-15(2)22(26-29(5)12-16(3)35-26)25(33)30-13-20(31)10-21(30)24(32)27-11-18-6-8-19(9-7-18)23-17(4)28-14-34-23/h6-9,12,14-15,20-22,26,31H,10-11,13H2,1-5H3,(H,27,32)/t20-,21+,22+,26?/m1/s1 |
| InChIKey | LSJQLHKMTJBYAJ-NWSVULJOSA-N |
| XLogP | 3.83 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.72 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |