About ethane;3-[2-(4-methyl-2,3-dihydropyrazin-1-yl)ethyl]-1,2-oxazole
ethane;3-[2-(4-methyl-2,3-dihydropyrazin-1-yl)ethyl]-1,2-oxazole (PubChem CID 142597143) has the molecular formula C12H21N3O
and a molecular weight of 223.32 g/mol. Its IUPAC name is ethane;3-[2-(4-methyl-2,3-dihydropyrazin-1-yl)ethyl]-1,2-oxazole.
Molecular Properties
| Compound Name | ethane;3-[2-(4-methyl-2,3-dihydropyrazin-1-yl)ethyl]-1,2-oxazole |
| PubChem CID | 142597143 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | ethane;3-[2-(4-methyl-2,3-dihydropyrazin-1-yl)ethyl]-1,2-oxazole |
| SMILES | CC.CN1C=CN(CCc2ccon2)CC1 |
| InChI | InChI=1S/C10H15N3O.C2H6/c1-12-5-7-13(8-6-12)4-2-10-3-9-14-11-10;1-2/h3,5,7,9H,2,4,6,8H2,1H3;1-2H3 |
| InChIKey | PGKUBOQDGQEAIT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;3-[2-(4-methyl-2,3-dihydropyrazin-1-yl)ethyl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-[2-(4-methyl-2,3-dihydropyrazin-1-yl)ethyl]-1,2-oxazole?
The IUPAC name of ethane;3-[2-(4-methyl-2,3-dihydropyrazin-1-yl)ethyl]-1,2-oxazole (CID 142597143) is ethane;3-[2-(4-methyl-2,3-dihydropyrazin-1-yl)ethyl]-1,2-oxazole.
What is the SMILES notation for ethane;3-[2-(4-methyl-2,3-dihydropyrazin-1-yl)ethyl]-1,2-oxazole?
The canonical SMILES for ethane;3-[2-(4-methyl-2,3-dihydropyrazin-1-yl)ethyl]-1,2-oxazole is CC.CN1C=CN(CCc2ccon2)CC1.
What is the InChIKey of ethane;3-[2-(4-methyl-2,3-dihydropyrazin-1-yl)ethyl]-1,2-oxazole?
The InChIKey is PGKUBOQDGQEAIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O.C2H6/c1-12-5-7-13(8-6-12)4-2-10-3-9-14-11-10;1-2/h3,5,7,9H,2,4,6,8H2,1H3;1-2H3.
What are the key properties of ethane;3-[2-(4-methyl-2,3-dihydropyrazin-1-yl)ethyl]-1,2-oxazole?
ethane;3-[2-(4-methyl-2,3-dihydropyrazin-1-yl)ethyl]-1,2-oxazole has a molecular weight of 223.32 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-[2-(4-methyl-2,3-dihydropyrazin-1-yl)ethyl]-1,2-oxazole is sourced from PubChem (CID 142597143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).