C32H33Cl2F3N2O4 — CID 142598275
(2S,8S)-2-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-2,4-dimethyl-9-(2,2,2-trifluoroethyl)-5,7,8,10-tetrahydro-3H-pyrido[4,3-h][1,4]benzoxazepine-8-carboxylic acid (PubChem CID 142598275) has the molecular formula C32H33Cl2F3N2O4 and a molecular weight of 637.53 g/mol. Its IUPAC name is (2S,8S)-2-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-2,4-dimethyl-9-(2,2,2-trifluoroethyl)-5,7,8,10-tetrahydro-3H-pyrido[4,3-h][1,4]benzoxazepine-8-carboxylic acid.
| Compound Name | (2S,8S)-2-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-2,4-dimethyl-9-(2,2,2-trifluoroethyl)-5,7,8,10-tetrahydro-3H-pyrido[4,3-h][1,4]benzoxazepine-8-carboxylic acid |
|---|---|
| PubChem CID | 142598275 |
| Molecular Formula | C32H33Cl2F3N2O4 |
| Molecular Weight | 637.53 g/mol |
| Exact Mass | 636.18 |
| IUPAC Name | (2S,8S)-2-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-2,4-dimethyl-9-(2,2,2-trifluoroethyl)-5,7,8,10-tetrahydro-3H-pyrido[4,3-h][1,4]benzoxazepine-8-carboxylic acid |
| SMILES | CC[C@@H](Oc1ccc([C@@]2(C)CN(C)Cc3cc4c(cc3O2)CN(CC(F)(F)F)[C@H](C(=O)O)C4)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C32H33Cl2F3N2O4/c1-4-28(19-5-10-25(33)26(34)12-19)42-24-8-6-23(7-9-24)31(2)17-38(3)15-22-11-20-13-27(30(40)41)39(18-32(35,36)37)16-21(20)14-29(22)43-31/h5-12,14,27-28H,4,13,15-18H2,1-3H3,(H,40,41)/t27-,28+,31+/m0/s1 |
| InChIKey | IQNNLLKFGUOMDL-WTNLLYQRSA-N |
| XLogP | 7.64 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.53 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |