C33H37Cl2NO4 — CID 142598302
methyl (4S,9S)-4-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-8-propan-2-yl-3,4,5,7,9,10-hexahydro-2H-oxepino[2,3-g]isoquinoline-9-carboxylate (PubChem CID 142598302) has the molecular formula C33H37Cl2NO4 and a molecular weight of 582.57 g/mol. Its IUPAC name is methyl (4S,9S)-4-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-8-propan-2-yl-3,4,5,7,9,10-hexahydro-2H-oxepino[2,3-g]isoquinoline-9-carboxylate.
| Compound Name | methyl (4S,9S)-4-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-8-propan-2-yl-3,4,5,7,9,10-hexahydro-2H-oxepino[2,3-g]isoquinoline-9-carboxylate |
|---|---|
| PubChem CID | 142598302 |
| Molecular Formula | C33H37Cl2NO4 |
| Molecular Weight | 582.57 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | methyl (4S,9S)-4-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-8-propan-2-yl-3,4,5,7,9,10-hexahydro-2H-oxepino[2,3-g]isoquinoline-9-carboxylate |
| SMILES | CC[C@@H](Oc1ccc([C@@H]2CCOc3cc4c(cc3C2)CN(C(C)C)[C@H](C(=O)OC)C4)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C33H37Cl2NO4/c1-5-31(23-8-11-28(34)29(35)16-23)40-27-9-6-21(7-10-27)22-12-13-39-32-18-24-17-30(33(37)38-4)36(20(2)3)19-26(24)15-25(32)14-22/h6-11,15-16,18,20,22,30-31H,5,12-14,17,19H2,1-4H3/t22-,30+,31-/m1/s1 |
| InChIKey | UTXRJTSEXZPRMJ-QSSDJRQSSA-N |
| XLogP | 7.94 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.57 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |