C37H37Cl2FN2O4 — CID 142598303
methyl (2S,8S)-2-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-9-[(3-fluorophenyl)methyl]-4-methyl-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8-carboxylate (PubChem CID 142598303) has the molecular formula C37H37Cl2FN2O4 and a molecular weight of 663.62 g/mol. Its IUPAC name is methyl (2S,8S)-2-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-9-[(3-fluorophenyl)methyl]-4-methyl-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8-carboxylate.
| Compound Name | methyl (2S,8S)-2-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-9-[(3-fluorophenyl)methyl]-4-methyl-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8-carboxylate |
|---|---|
| PubChem CID | 142598303 |
| Molecular Formula | C37H37Cl2FN2O4 |
| Molecular Weight | 663.62 g/mol |
| Exact Mass | 662.21 |
| IUPAC Name | methyl (2S,8S)-2-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-9-[(3-fluorophenyl)methyl]-4-methyl-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8-carboxylate |
| SMILES | CC[C@@H](Oc1ccc([C@H]2CN(C)Cc3cc4c(cc3O2)CN(Cc2cccc(F)c2)[C@H](C(=O)OC)C4)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C37H37Cl2FN2O4/c1-4-34(25-10-13-31(38)32(39)16-25)45-30-11-8-24(9-12-30)36-22-41(2)20-28-15-26-17-33(37(43)44-3)42(21-27(26)18-35(28)46-36)19-23-6-5-7-29(40)14-23/h5-16,18,33-34,36H,4,17,19-22H2,1-3H3/t33-,34+,36+/m0/s1 |
| InChIKey | NQOQNBCBQIWJAY-GABYNLOESA-N |
| XLogP | 8.33 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.62 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |