C36H39Cl2NO8 — CID 142598305
8-O-tert-butyl 9-O-methyl (9S)-4-[4-[2-acetyloxy-1-(3,4-dichlorophenyl)ethoxy]phenyl]-3,4,5,7,9,10-hexahydro-2H-oxepino[2,3-g]isoquinoline-8,9-dicarboxylate (PubChem CID 142598305) has the molecular formula C36H39Cl2NO8 and a molecular weight of 684.61 g/mol. Its IUPAC name is 8-O-tert-butyl 9-O-methyl (9S)-4-[4-[2-acetyloxy-1-(3,4-dichlorophenyl)ethoxy]phenyl]-3,4,5,7,9,10-hexahydro-2H-oxepino[2,3-g]isoquinoline-8,9-dicarboxylate.
| Compound Name | 8-O-tert-butyl 9-O-methyl (9S)-4-[4-[2-acetyloxy-1-(3,4-dichlorophenyl)ethoxy]phenyl]-3,4,5,7,9,10-hexahydro-2H-oxepino[2,3-g]isoquinoline-8,9-dicarboxylate |
|---|---|
| PubChem CID | 142598305 |
| Molecular Formula | C36H39Cl2NO8 |
| Molecular Weight | 684.61 g/mol |
| Exact Mass | 683.21 |
| IUPAC Name | 8-O-tert-butyl 9-O-methyl (9S)-4-[4-[2-acetyloxy-1-(3,4-dichlorophenyl)ethoxy]phenyl]-3,4,5,7,9,10-hexahydro-2H-oxepino[2,3-g]isoquinoline-8,9-dicarboxylate |
| SMILES | COC(=O)[C@@H]1Cc2cc3c(cc2CN1C(=O)OC(C)(C)C)CC(c1ccc(OC(COC(C)=O)c2ccc(Cl)c(Cl)c2)cc1)CCO3 |
| InChI | InChI=1S/C36H39Cl2NO8/c1-21(40)45-20-33(24-8-11-29(37)30(38)16-24)46-28-9-6-22(7-10-28)23-12-13-44-32-18-25-17-31(34(41)43-5)39(35(42)47-36(2,3)4)19-27(25)15-26(32)14-23/h6-11,15-16,18,23,31,33H,12-14,17,19-20H2,1-5H3/t23?,31-,33?/m0/s1 |
| InChIKey | KGZYDXLDZXWKQH-MBOZEEDYSA-N |
| XLogP | 7.62 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.61 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|