C38H37Cl2FN2O5 — CID 142598311
methyl (2S,8S)-4-acetyl-2-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-9-[(3-fluorophenyl)methyl]-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8-carboxylate (PubChem CID 142598311) has the molecular formula C38H37Cl2FN2O5 and a molecular weight of 691.63 g/mol. Its IUPAC name is methyl (2S,8S)-4-acetyl-2-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-9-[(3-fluorophenyl)methyl]-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8-carboxylate.
| Compound Name | methyl (2S,8S)-4-acetyl-2-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-9-[(3-fluorophenyl)methyl]-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8-carboxylate |
|---|---|
| PubChem CID | 142598311 |
| Molecular Formula | C38H37Cl2FN2O5 |
| Molecular Weight | 691.63 g/mol |
| Exact Mass | 690.21 |
| IUPAC Name | methyl (2S,8S)-4-acetyl-2-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-9-[(3-fluorophenyl)methyl]-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8-carboxylate |
| SMILES | CC[C@@H](Oc1ccc([C@H]2CN(C(C)=O)Cc3cc4c(cc3O2)CN(Cc2cccc(F)c2)[C@H](C(=O)OC)C4)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C38H37Cl2FN2O5/c1-4-35(26-10-13-32(39)33(40)16-26)47-31-11-8-25(9-12-31)37-22-42(23(2)44)21-29-15-27-17-34(38(45)46-3)43(20-28(27)18-36(29)48-37)19-24-6-5-7-30(41)14-24/h5-16,18,34-35,37H,4,17,19-22H2,1-3H3/t34-,35+,37+/m0/s1 |
| InChIKey | HAAAAEJCPTYWKI-UQDPWRLZSA-N |
| XLogP | 8.24 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.63 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |