C34H30Cl2FNO4 — CID 142598344
(9S)-4-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-8-[(2-fluorophenyl)methyl]-3,4,5,7,9,10-hexahydro-2H-oxepino[2,3-g]isoquinoline-9-carboxylic acid (PubChem CID 142598344) has the molecular formula C34H30Cl2FNO4 and a molecular weight of 606.52 g/mol. Its IUPAC name is (9S)-4-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-8-[(2-fluorophenyl)methyl]-3,4,5,7,9,10-hexahydro-2H-oxepino[2,3-g]isoquinoline-9-carboxylic acid.
| Compound Name | (9S)-4-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-8-[(2-fluorophenyl)methyl]-3,4,5,7,9,10-hexahydro-2H-oxepino[2,3-g]isoquinoline-9-carboxylic acid |
|---|---|
| PubChem CID | 142598344 |
| Molecular Formula | C34H30Cl2FNO4 |
| Molecular Weight | 606.52 g/mol |
| Exact Mass | 605.15 |
| IUPAC Name | (9S)-4-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-8-[(2-fluorophenyl)methyl]-3,4,5,7,9,10-hexahydro-2H-oxepino[2,3-g]isoquinoline-9-carboxylic acid |
| SMILES | O=C(O)[C@@H]1Cc2cc3c(cc2CN1Cc1ccccc1F)CC(c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1)CCO3 |
| InChI | InChI=1S/C34H30Cl2FNO4/c35-29-10-5-21(13-30(29)36)20-42-28-8-6-22(7-9-28)23-11-12-41-33-17-25-16-32(34(39)40)38(19-27(25)15-26(33)14-23)18-24-3-1-2-4-31(24)37/h1-10,13,15,17,23,32H,11-12,14,16,18-20H2,(H,39,40)/t23?,32-/m0/s1 |
| InChIKey | WNFXMYWDOAAGAH-ZXFDNSAJSA-N |
| XLogP | 7.83 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.52 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |