C28H29FN2O4 — CID 142598380
methyl (4R,9S)-8-[(3-fluorophenyl)methyl]-4-(4-hydroxyphenyl)-1-methyl-2,3,4,7,9,10-hexahydropyrido[4,3-h][1,5]benzoxazepine-9-carboxylate (PubChem CID 142598380) has the molecular formula C28H29FN2O4 and a molecular weight of 476.55 g/mol. Its IUPAC name is methyl (4R,9S)-8-[(3-fluorophenyl)methyl]-4-(4-hydroxyphenyl)-1-methyl-2,3,4,7,9,10-hexahydropyrido[4,3-h][1,5]benzoxazepine-9-carboxylate.
| Compound Name | methyl (4R,9S)-8-[(3-fluorophenyl)methyl]-4-(4-hydroxyphenyl)-1-methyl-2,3,4,7,9,10-hexahydropyrido[4,3-h][1,5]benzoxazepine-9-carboxylate |
|---|---|
| PubChem CID | 142598380 |
| Molecular Formula | C28H29FN2O4 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | methyl (4R,9S)-8-[(3-fluorophenyl)methyl]-4-(4-hydroxyphenyl)-1-methyl-2,3,4,7,9,10-hexahydropyrido[4,3-h][1,5]benzoxazepine-9-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2cc3c(cc2CN1Cc1cccc(F)c1)O[C@@H](c1ccc(O)cc1)CCN3C |
| InChI | InChI=1S/C28H29FN2O4/c1-30-11-10-26(19-6-8-23(32)9-7-19)35-27-15-21-17-31(16-18-4-3-5-22(29)12-18)25(28(33)34-2)14-20(21)13-24(27)30/h3-9,12-13,15,25-26,32H,10-11,14,16-17H2,1-2H3/t25-,26+/m0/s1 |
| InChIKey | CHNLYNKTTGEIIG-IZZNHLLZSA-N |
| XLogP | 4.59 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|