C25H32N2O4 — CID 142598392
methyl (4R,9S)-4-(4-hydroxyphenyl)-1-methyl-8-(2-methylpropyl)-2,3,4,7,9,10-hexahydropyrido[4,3-h][1,5]benzoxazepine-9-carboxylate (PubChem CID 142598392) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is methyl (4R,9S)-4-(4-hydroxyphenyl)-1-methyl-8-(2-methylpropyl)-2,3,4,7,9,10-hexahydropyrido[4,3-h][1,5]benzoxazepine-9-carboxylate.
| Compound Name | methyl (4R,9S)-4-(4-hydroxyphenyl)-1-methyl-8-(2-methylpropyl)-2,3,4,7,9,10-hexahydropyrido[4,3-h][1,5]benzoxazepine-9-carboxylate |
|---|---|
| PubChem CID | 142598392 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | methyl (4R,9S)-4-(4-hydroxyphenyl)-1-methyl-8-(2-methylpropyl)-2,3,4,7,9,10-hexahydropyrido[4,3-h][1,5]benzoxazepine-9-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2cc3c(cc2CN1CC(C)C)O[C@@H](c1ccc(O)cc1)CCN3C |
| InChI | InChI=1S/C25H32N2O4/c1-16(2)14-27-15-19-13-24-21(11-18(19)12-22(27)25(29)30-4)26(3)10-9-23(31-24)17-5-7-20(28)8-6-17/h5-8,11,13,16,22-23,28H,9-10,12,14-15H2,1-4H3/t22-,23+/m0/s1 |
| InChIKey | VRFCPBBBBGVERD-XZOQPEGZSA-N |
| XLogP | 3.91 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|