C32H33Cl2F3N2O4 — CID 142598420
methyl (2S,8S)-2-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-4-methyl-9-(2,2,2-trifluoroethyl)-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8-carboxylate (PubChem CID 142598420) has the molecular formula C32H33Cl2F3N2O4 and a molecular weight of 637.53 g/mol. Its IUPAC name is methyl (2S,8S)-2-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-4-methyl-9-(2,2,2-trifluoroethyl)-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8-carboxylate.
| Compound Name | methyl (2S,8S)-2-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-4-methyl-9-(2,2,2-trifluoroethyl)-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8-carboxylate |
|---|---|
| PubChem CID | 142598420 |
| Molecular Formula | C32H33Cl2F3N2O4 |
| Molecular Weight | 637.53 g/mol |
| Exact Mass | 636.18 |
| IUPAC Name | methyl (2S,8S)-2-[4-[(1R)-1-(3,4-dichlorophenyl)propoxy]phenyl]-4-methyl-9-(2,2,2-trifluoroethyl)-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8-carboxylate |
| SMILES | CC[C@@H](Oc1ccc([C@H]2CN(C)Cc3cc4c(cc3O2)CN(CC(F)(F)F)[C@H](C(=O)OC)C4)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C32H33Cl2F3N2O4/c1-4-28(20-7-10-25(33)26(34)12-20)42-24-8-5-19(6-9-24)30-17-38(2)15-23-11-21-13-27(31(40)41-3)39(18-32(35,36)37)16-22(21)14-29(23)43-30/h5-12,14,27-28,30H,4,13,15-18H2,1-3H3/t27-,28+,30+/m0/s1 |
| InChIKey | YHUGHBKMCBRKNV-PKZQBKLLSA-N |
| XLogP | 7.55 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.53 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |