C39H39Cl2FN2O5 — CID 142598443
(2S,8S)-2-[4-[(R)-(3,4-dichlorophenyl)-(oxan-4-yl)methoxy]phenyl]-9-[(3-fluorophenyl)methyl]-4-methyl-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8-carboxylic acid (PubChem CID 142598443) has the molecular formula C39H39Cl2FN2O5 and a molecular weight of 705.65 g/mol. Its IUPAC name is (2S,8S)-2-[4-[(R)-(3,4-dichlorophenyl)-(oxan-4-yl)methoxy]phenyl]-9-[(3-fluorophenyl)methyl]-4-methyl-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8-carboxylic acid.
| Compound Name | (2S,8S)-2-[4-[(R)-(3,4-dichlorophenyl)-(oxan-4-yl)methoxy]phenyl]-9-[(3-fluorophenyl)methyl]-4-methyl-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8-carboxylic acid |
|---|---|
| PubChem CID | 142598443 |
| Molecular Formula | C39H39Cl2FN2O5 |
| Molecular Weight | 705.65 g/mol |
| Exact Mass | 704.22 |
| IUPAC Name | (2S,8S)-2-[4-[(R)-(3,4-dichlorophenyl)-(oxan-4-yl)methoxy]phenyl]-9-[(3-fluorophenyl)methyl]-4-methyl-2,3,5,7,8,10-hexahydropyrido[4,3-h][1,4]benzoxazepine-8-carboxylic acid |
| SMILES | CN1Cc2cc3c(cc2O[C@@H](c2ccc(O[C@@H](c4ccc(Cl)c(Cl)c4)C4CCOCC4)cc2)C1)CN(Cc1cccc(F)c1)[C@H](C(=O)O)C3 |
| InChI | InChI=1S/C39H39Cl2FN2O5/c1-43-21-30-16-28-18-35(39(45)46)44(20-24-3-2-4-31(42)15-24)22-29(28)19-36(30)49-37(23-43)25-5-8-32(9-6-25)48-38(26-11-13-47-14-12-26)27-7-10-33(40)34(41)17-27/h2-10,15-17,19,26,35,37-38H,11-14,18,20-23H2,1H3,(H,45,46)/t35-,37+,38+/m0/s1 |
| InChIKey | ZIYJQBODIWDQJW-KFHIMVBXSA-N |
| XLogP | 8.26 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.65 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |