C35H39F2NO6 — CID 142598450
8-O-tert-butyl 9-O-methyl (4S,9S)-4-[4-[(1R)-1-(3,4-difluorophenyl)propoxy]phenyl]-3,4,5,7,9,10-hexahydro-2H-oxepino[2,3-g]isoquinoline-8,9-dicarboxylate (PubChem CID 142598450) has the molecular formula C35H39F2NO6 and a molecular weight of 607.69 g/mol. Its IUPAC name is 8-O-tert-butyl 9-O-methyl (4S,9S)-4-[4-[(1R)-1-(3,4-difluorophenyl)propoxy]phenyl]-3,4,5,7,9,10-hexahydro-2H-oxepino[2,3-g]isoquinoline-8,9-dicarboxylate.
| Compound Name | 8-O-tert-butyl 9-O-methyl (4S,9S)-4-[4-[(1R)-1-(3,4-difluorophenyl)propoxy]phenyl]-3,4,5,7,9,10-hexahydro-2H-oxepino[2,3-g]isoquinoline-8,9-dicarboxylate |
|---|---|
| PubChem CID | 142598450 |
| Molecular Formula | C35H39F2NO6 |
| Molecular Weight | 607.69 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | 8-O-tert-butyl 9-O-methyl (4S,9S)-4-[4-[(1R)-1-(3,4-difluorophenyl)propoxy]phenyl]-3,4,5,7,9,10-hexahydro-2H-oxepino[2,3-g]isoquinoline-8,9-dicarboxylate |
| SMILES | CC[C@@H](Oc1ccc([C@@H]2CCOc3cc4c(cc3C2)CN(C(=O)OC(C)(C)C)[C@H](C(=O)OC)C4)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C35H39F2NO6/c1-6-31(23-9-12-28(36)29(37)17-23)43-27-10-7-21(8-11-27)22-13-14-42-32-19-24-18-30(33(39)41-5)38(34(40)44-35(2,3)4)20-26(24)16-25(32)15-22/h7-12,16-17,19,22,30-31H,6,13-15,18,20H2,1-5H3/t22-,30+,31-/m1/s1 |
| InChIKey | AJJZKJMSUSZNSM-QSSDJRQSSA-N |
| XLogP | 7.44 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.69 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |