C20H16ClN5O — CID 142598716
(7S)-5-(4-chlorophenyl)-3-imidazo[1,2-a]pyridin-6-yl-7-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one (PubChem CID 142598716) has the molecular formula C20H16ClN5O and a molecular weight of 377.84 g/mol. Its IUPAC name is (7S)-5-(4-chlorophenyl)-3-imidazo[1,2-a]pyridin-6-yl-7-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | (7S)-5-(4-chlorophenyl)-3-imidazo[1,2-a]pyridin-6-yl-7-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 142598716 |
| Molecular Formula | C20H16ClN5O |
| Molecular Weight | 377.84 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | (7S)-5-(4-chlorophenyl)-3-imidazo[1,2-a]pyridin-6-yl-7-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one |
| SMILES | C[C@H]1CN(c2ccc(Cl)cc2)C(=O)c2c(-c3ccc4nccn4c3)cnn21 |
| InChI | InChI=1S/C20H16ClN5O/c1-13-11-25(16-5-3-15(21)4-6-16)20(27)19-17(10-23-26(13)19)14-2-7-18-22-8-9-24(18)12-14/h2-10,12-13H,11H2,1H3/t13-/m0/s1 |
| InChIKey | CVRYRVUZCUKEOR-ZDUSSCGKSA-N |
| XLogP | 4.07 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.84 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|