C15H23NO3 — CID 142598983
2,2-dimethylpropanoyl (2E,4E)-4-ethyl-6-ethyliminohexa-2,4-dienoate (PubChem CID 142598983) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 2,2-dimethylpropanoyl (2E,4E)-4-ethyl-6-ethyliminohexa-2,4-dienoate.
| Compound Name | 2,2-dimethylpropanoyl (2E,4E)-4-ethyl-6-ethyliminohexa-2,4-dienoate |
|---|---|
| PubChem CID | 142598983 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 2,2-dimethylpropanoyl (2E,4E)-4-ethyl-6-ethyliminohexa-2,4-dienoate |
| SMILES | CC/N=C/C=C(/C=C/C(=O)OC(=O)C(C)(C)C)CC |
| InChI | InChI=1S/C15H23NO3/c1-6-12(10-11-16-7-2)8-9-13(17)19-14(18)15(3,4)5/h8-11H,6-7H2,1-5H3/b9-8+,12-10+,16-11+ |
| InChIKey | PKMGMQXCGONJKP-IIFVLVBTSA-N |
| XLogP | 3.09 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|