C12H21NO4S3 — CID 142599479
1-[(3S,4R)-4-thiophen-2-ylsulfonylthiolan-3-yl]pyrrolidine;dihydrate (PubChem CID 142599479) has the molecular formula C12H21NO4S3 and a molecular weight of 339.50 g/mol. Its IUPAC name is 1-[(3S,4R)-4-thiophen-2-ylsulfonylthiolan-3-yl]pyrrolidine;dihydrate.
| Compound Name | 1-[(3S,4R)-4-thiophen-2-ylsulfonylthiolan-3-yl]pyrrolidine;dihydrate |
|---|---|
| PubChem CID | 142599479 |
| Molecular Formula | C12H21NO4S3 |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 1-[(3S,4R)-4-thiophen-2-ylsulfonylthiolan-3-yl]pyrrolidine;dihydrate |
| SMILES | O.O.O=S(=O)(c1cccs1)[C@H]1CSC[C@@H]1N1CCCC1 |
| InChI | InChI=1S/C12H17NO2S3.2H2O/c14-18(15,12-4-3-7-17-12)11-9-16-8-10(11)13-5-1-2-6-13;;/h3-4,7,10-11H,1-2,5-6,8-9H2;2*1H2/t10-,11-;;/m0../s1 |
| InChIKey | XGBZMNQZISTPNZ-ULEGLUPFSA-N |
| XLogP | 0.45 |
| TPSA | 100.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |