About pyrrolidine;2-(thiolan-3-ylsulfanyl)thiophene
pyrrolidine;2-(thiolan-3-ylsulfanyl)thiophene (PubChem CID 142599505) has the molecular formula C12H19NS3
and a molecular weight of 273.49 g/mol. Its IUPAC name is pyrrolidine;2-(thiolan-3-ylsulfanyl)thiophene.
Molecular Properties
| Compound Name | pyrrolidine;2-(thiolan-3-ylsulfanyl)thiophene |
| PubChem CID | 142599505 |
| Molecular Formula | C12H19NS3 |
| Molecular Weight | 273.49 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | pyrrolidine;2-(thiolan-3-ylsulfanyl)thiophene |
| SMILES | C1CCNC1.c1csc(SC2CCSC2)c1 |
| InChI | InChI=1S/C8H10S3.C4H9N/c1-2-8(10-4-1)11-7-3-5-9-6-7;1-2-4-5-3-1/h1-2,4,7H,3,5-6H2;5H,1-4H2 |
| InChIKey | HJDJVKCZORPYFK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrrolidine;2-(thiolan-3-ylsulfanyl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidine;2-(thiolan-3-ylsulfanyl)thiophene?
The IUPAC name of pyrrolidine;2-(thiolan-3-ylsulfanyl)thiophene (CID 142599505) is pyrrolidine;2-(thiolan-3-ylsulfanyl)thiophene.
What is the SMILES notation for pyrrolidine;2-(thiolan-3-ylsulfanyl)thiophene?
The canonical SMILES for pyrrolidine;2-(thiolan-3-ylsulfanyl)thiophene is C1CCNC1.c1csc(SC2CCSC2)c1.
What is the InChIKey of pyrrolidine;2-(thiolan-3-ylsulfanyl)thiophene?
The InChIKey is HJDJVKCZORPYFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10S3.C4H9N/c1-2-8(10-4-1)11-7-3-5-9-6-7;1-2-4-5-3-1/h1-2,4,7H,3,5-6H2;5H,1-4H2.
What are the key properties of pyrrolidine;2-(thiolan-3-ylsulfanyl)thiophene?
pyrrolidine;2-(thiolan-3-ylsulfanyl)thiophene has a molecular weight of 273.49 g/mol, XLogP of 3.72, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidine;2-(thiolan-3-ylsulfanyl)thiophene is sourced from PubChem (CID 142599505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).