About 5-[4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]phthalazin-1-yl]-2-methylbenzenethiol
5-[4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]phthalazin-1-yl]-2-methylbenzenethiol (PubChem CID 142599528) has the molecular formula C22H19N3S2
and a molecular weight of 389.55 g/mol. Its IUPAC name is 5-[4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]phthalazin-1-yl]-2-methylbenzenethiol.
Molecular Properties
| Compound Name | 5-[4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]phthalazin-1-yl]-2-methylbenzenethiol |
| PubChem CID | 142599528 |
| Molecular Formula | C22H19N3S2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 5-[4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]phthalazin-1-yl]-2-methylbenzenethiol |
| SMILES | Cc1cc(C)nc(Sc2nnc(-c3ccc(C)c(S)c3)c3ccccc23)c1 |
| InChI | InChI=1S/C22H19N3S2/c1-13-10-15(3)23-20(11-13)27-22-18-7-5-4-6-17(18)21(24-25-22)16-9-8-14(2)19(26)12-16/h4-12,26H,1-3H3 |
| InChIKey | AZCSENSKEBEGIH-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 38.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]phthalazin-1-yl]-2-methylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]phthalazin-1-yl]-2-methylbenzenethiol?
The IUPAC name of 5-[4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]phthalazin-1-yl]-2-methylbenzenethiol (CID 142599528) is 5-[4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]phthalazin-1-yl]-2-methylbenzenethiol.
What is the SMILES notation for 5-[4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]phthalazin-1-yl]-2-methylbenzenethiol?
The canonical SMILES for 5-[4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]phthalazin-1-yl]-2-methylbenzenethiol is Cc1cc(C)nc(Sc2nnc(-c3ccc(C)c(S)c3)c3ccccc23)c1.
What is the InChIKey of 5-[4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]phthalazin-1-yl]-2-methylbenzenethiol?
The InChIKey is AZCSENSKEBEGIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3S2/c1-13-10-15(3)23-20(11-13)27-22-18-7-5-4-6-17(18)21(24-25-22)16-9-8-14(2)19(26)12-16/h4-12,26H,1-3H3.
What are the key properties of 5-[4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]phthalazin-1-yl]-2-methylbenzenethiol?
5-[4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]phthalazin-1-yl]-2-methylbenzenethiol has a molecular weight of 389.55 g/mol, XLogP of 6.06, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]phthalazin-1-yl]-2-methylbenzenethiol is sourced from PubChem (CID 142599528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).