C23H25N3O — CID 142600044
(3Z,6E)-6-methyl-9-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2,5-dimethylidene-8-methylimino-9-oxonona-3,6-dienenitrile (PubChem CID 142600044) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is (3Z,6E)-6-methyl-9-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2,5-dimethylidene-8-methylimino-9-oxonona-3,6-dienenitrile.
| Compound Name | (3Z,6E)-6-methyl-9-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2,5-dimethylidene-8-methylimino-9-oxonona-3,6-dienenitrile |
|---|---|
| PubChem CID | 142600044 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | (3Z,6E)-6-methyl-9-(1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2,5-dimethylidene-8-methylimino-9-oxonona-3,6-dienenitrile |
| SMILES | C=C(C#N)/C=C\C(=C)/C(C)=C/C(=N\C)C(=O)N1CCc2ccccc2C1C |
| InChI | InChI=1S/C23H25N3O/c1-16(15-24)10-11-17(2)18(3)14-22(25-5)23(27)26-13-12-20-8-6-7-9-21(20)19(26)4/h6-11,14,19H,1-2,12-13H2,3-5H3/b11-10-,18-14+,25-22+ |
| InChIKey | CBOYNCDMSDMTLK-POFJPXFMSA-N |
| XLogP | 4.34 |
| TPSA | 56.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|