C13H17ClFNO — CID 142600148
(3S)-1-(4-chloro-3-fluorophenyl)-3-(2-methoxyethyl)pyrrolidine (PubChem CID 142600148) has the molecular formula C13H17ClFNO and a molecular weight of 257.74 g/mol. Its IUPAC name is (3S)-1-(4-chloro-3-fluorophenyl)-3-(2-methoxyethyl)pyrrolidine.
| Compound Name | (3S)-1-(4-chloro-3-fluorophenyl)-3-(2-methoxyethyl)pyrrolidine |
|---|---|
| PubChem CID | 142600148 |
| Molecular Formula | C13H17ClFNO |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | (3S)-1-(4-chloro-3-fluorophenyl)-3-(2-methoxyethyl)pyrrolidine |
| SMILES | COCC[C@@H]1CCN(c2ccc(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C13H17ClFNO/c1-17-7-5-10-4-6-16(9-10)11-2-3-12(14)13(15)8-11/h2-3,8,10H,4-7,9H2,1H3/t10-/m0/s1 |
| InChIKey | AMRHHPAWHRQMBK-JTQLQIEISA-N |
| XLogP | 3.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |