C18H26OSi — CID 142600854
(1S,3aR)-1,7a-dimethyl-1-(4-trimethylsilylbuta-1,3-diynyl)-2,3,3a,5,6,7-hexahydroinden-4-one (PubChem CID 142600854) has the molecular formula C18H26OSi and a molecular weight of 286.49 g/mol. Its IUPAC name is (1S,3aR)-1,7a-dimethyl-1-(4-trimethylsilylbuta-1,3-diynyl)-2,3,3a,5,6,7-hexahydroinden-4-one.
| Compound Name | (1S,3aR)-1,7a-dimethyl-1-(4-trimethylsilylbuta-1,3-diynyl)-2,3,3a,5,6,7-hexahydroinden-4-one |
|---|---|
| PubChem CID | 142600854 |
| Molecular Formula | C18H26OSi |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (1S,3aR)-1,7a-dimethyl-1-(4-trimethylsilylbuta-1,3-diynyl)-2,3,3a,5,6,7-hexahydroinden-4-one |
| SMILES | CC12CCCC(=O)[C@@H]1CC[C@]2(C)C#CC#C[Si](C)(C)C |
| InChI | InChI=1S/C18H26OSi/c1-17(11-6-7-14-20(3,4)5)13-10-15-16(19)9-8-12-18(15,17)2/h15H,8-10,12-13H2,1-5H3/t15-,17-,18?/m0/s1 |
| InChIKey | RRIIHUYYTDFEIZ-LUIZSJORSA-N |
| XLogP | 4.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|