C18H19Cl2N3O — CID 142600952
1-[(3,4-dichlorophenyl)methyl]-5-[2-(ethylamino)ethyl]pyrrolo[3,2-c]pyridin-4-one (PubChem CID 142600952) has the molecular formula C18H19Cl2N3O and a molecular weight of 364.28 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-5-[2-(ethylamino)ethyl]pyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-5-[2-(ethylamino)ethyl]pyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 142600952 |
| Molecular Formula | C18H19Cl2N3O |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-5-[2-(ethylamino)ethyl]pyrrolo[3,2-c]pyridin-4-one |
| SMILES | CCNCCn1ccc2c(ccn2Cc2ccc(Cl)c(Cl)c2)c1=O |
| InChI | InChI=1S/C18H19Cl2N3O/c1-2-21-7-10-22-9-6-17-14(18(22)24)5-8-23(17)12-13-3-4-15(19)16(20)11-13/h3-6,8-9,11,21H,2,7,10,12H2,1H3 |
| InChIKey | OXVXJPQPBGXHJG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|