C23H34N2O — CID 142601143
N-[[5-[(2-ethoxyethylamino)methyl]-2-phenylphenyl]methyl]-3-methylbutan-1-amine (PubChem CID 142601143) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is N-[[5-[(2-ethoxyethylamino)methyl]-2-phenylphenyl]methyl]-3-methylbutan-1-amine.
| Compound Name | N-[[5-[(2-ethoxyethylamino)methyl]-2-phenylphenyl]methyl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 142601143 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | N-[[5-[(2-ethoxyethylamino)methyl]-2-phenylphenyl]methyl]-3-methylbutan-1-amine |
| SMILES | CCOCCNCc1ccc(-c2ccccc2)c(CNCCC(C)C)c1 |
| InChI | InChI=1S/C23H34N2O/c1-4-26-15-14-25-17-20-10-11-23(21-8-6-5-7-9-21)22(16-20)18-24-13-12-19(2)3/h5-11,16,19,24-25H,4,12-15,17-18H2,1-3H3 |
| InChIKey | RLPGUEKRZXZBOJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|