C30H35IO3P2 — CID 142601402
8-butyl-4-iodo-2,10-dimethyl-6-[[(2R,5R)-2-methyl-5-phenylphospholan-1-yl]methoxy]benzo[d][1,3,2]benzodioxaphosphepine (PubChem CID 142601402) has the molecular formula C30H35IO3P2 and a molecular weight of 632.46 g/mol. Its IUPAC name is 8-butyl-4-iodo-2,10-dimethyl-6-[[(2R,5R)-2-methyl-5-phenylphospholan-1-yl]methoxy]benzo[d][1,3,2]benzodioxaphosphepine.
| Compound Name | 8-butyl-4-iodo-2,10-dimethyl-6-[[(2R,5R)-2-methyl-5-phenylphospholan-1-yl]methoxy]benzo[d][1,3,2]benzodioxaphosphepine |
|---|---|
| PubChem CID | 142601402 |
| Molecular Formula | C30H35IO3P2 |
| Molecular Weight | 632.46 g/mol |
| Exact Mass | 632.11 |
| IUPAC Name | 8-butyl-4-iodo-2,10-dimethyl-6-[[(2R,5R)-2-methyl-5-phenylphospholan-1-yl]methoxy]benzo[d][1,3,2]benzodioxaphosphepine |
| SMILES | CCCCc1cc(C)cc2c1op(OCP1[C@H](C)CC[C@@H]1c1ccccc1)oc1c(I)cc(C)cc12 |
| InChI | InChI=1S/C30H35IO3P2/c1-5-6-10-24-15-20(2)16-25-26-17-21(3)18-27(31)30(26)34-36(33-29(24)25)32-19-35-22(4)13-14-28(35)23-11-8-7-9-12-23/h7-9,11-12,15-18,22,28H,5-6,10,13-14,19H2,1-4H3/t22-,28-,35?,36?/m1/s1 |
| InChIKey | QRPSTOARXTZYTD-ONEHYHKASA-N |
| XLogP | 10.65 |
| TPSA | 35.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.46 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|