C23H24Cl2N2O2 — CID 142601846
(3,5-dichlorophenyl)methyl N-methyl-N-[6-(1,2,3,6-tetrahydropyridin-4-yl)-2,3-dihydro-1H-inden-1-yl]carbamate (PubChem CID 142601846) has the molecular formula C23H24Cl2N2O2 and a molecular weight of 431.36 g/mol. Its IUPAC name is (3,5-dichlorophenyl)methyl N-methyl-N-[6-(1,2,3,6-tetrahydropyridin-4-yl)-2,3-dihydro-1H-inden-1-yl]carbamate.
| Compound Name | (3,5-dichlorophenyl)methyl N-methyl-N-[6-(1,2,3,6-tetrahydropyridin-4-yl)-2,3-dihydro-1H-inden-1-yl]carbamate |
|---|---|
| PubChem CID | 142601846 |
| Molecular Formula | C23H24Cl2N2O2 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | (3,5-dichlorophenyl)methyl N-methyl-N-[6-(1,2,3,6-tetrahydropyridin-4-yl)-2,3-dihydro-1H-inden-1-yl]carbamate |
| SMILES | CN(C(=O)OCc1cc(Cl)cc(Cl)c1)C1CCc2ccc(C3=CCNCC3)cc21 |
| InChI | InChI=1S/C23H24Cl2N2O2/c1-27(23(28)29-14-15-10-19(24)13-20(25)11-15)22-5-4-17-2-3-18(12-21(17)22)16-6-8-26-9-7-16/h2-3,6,10-13,22,26H,4-5,7-9,14H2,1H3 |
| InChIKey | BTICEQBAFYCDRK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |