C10H12BClO2 — CID 142601963
7-chloro-1-hydroxy-3,3,6-trimethyl-2,1-benzoxaborole (PubChem CID 142601963) has the molecular formula C10H12BClO2 and a molecular weight of 210.47 g/mol. Its IUPAC name is 7-chloro-1-hydroxy-3,3,6-trimethyl-2,1-benzoxaborole.
| Compound Name | 7-chloro-1-hydroxy-3,3,6-trimethyl-2,1-benzoxaborole |
|---|---|
| PubChem CID | 142601963 |
| Molecular Formula | C10H12BClO2 |
| Molecular Weight | 210.47 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 7-chloro-1-hydroxy-3,3,6-trimethyl-2,1-benzoxaborole |
| SMILES | Cc1ccc2c(c1Cl)B(O)OC2(C)C |
| InChI | InChI=1S/C10H12BClO2/c1-6-4-5-7-8(9(6)12)11(13)14-10(7,2)3/h4-5,13H,1-3H3 |
| InChIKey | MMBQHTOJSJBEFY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.47 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|