C6H5Cl3F6O — CID 142602918
1,1-dichloro-1-(1-chloro-3,3,3-trifluoropropoxy)-3,3,3-trifluoropropane (PubChem CID 142602918) has the molecular formula C6H5Cl3F6O and a molecular weight of 313.45 g/mol. Its IUPAC name is 1,1-dichloro-1-(1-chloro-3,3,3-trifluoropropoxy)-3,3,3-trifluoropropane.
| Compound Name | 1,1-dichloro-1-(1-chloro-3,3,3-trifluoropropoxy)-3,3,3-trifluoropropane |
|---|---|
| PubChem CID | 142602918 |
| Molecular Formula | C6H5Cl3F6O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 311.93 |
| IUPAC Name | 1,1-dichloro-1-(1-chloro-3,3,3-trifluoropropoxy)-3,3,3-trifluoropropane |
| SMILES | FC(F)(F)CC(Cl)OC(Cl)(Cl)CC(F)(F)F |
| InChI | InChI=1S/C6H5Cl3F6O/c7-3(1-5(10,11)12)16-4(8,9)2-6(13,14)15/h3H,1-2H2 |
| InChIKey | WKOYQNQJICDBJG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|