About 4-ethyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene;nonane
4-ethyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene;nonane (PubChem CID 142603215) has the molecular formula C19H34S
and a molecular weight of 294.55 g/mol. Its IUPAC name is 4-ethyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene;nonane.
Molecular Properties
| Compound Name | 4-ethyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene;nonane |
| PubChem CID | 142603215 |
| Molecular Formula | C19H34S |
| Molecular Weight | 294.55 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | 4-ethyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene;nonane |
| SMILES | CCC1CCc2scc(C)c21.CCCCCCCCC |
| InChI | InChI=1S/C10H14S.C9H20/c1-3-8-4-5-9-10(8)7(2)6-11-9;1-3-5-7-9-8-6-4-2/h6,8H,3-5H2,1-2H3;3-9H2,1-2H3 |
| InChIKey | SIGVWGDIMPRUIZ-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.55 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene;nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene;nonane?
The IUPAC name of 4-ethyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene;nonane (CID 142603215) is 4-ethyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene;nonane.
What is the SMILES notation for 4-ethyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene;nonane?
The canonical SMILES for 4-ethyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene;nonane is CCC1CCc2scc(C)c21.CCCCCCCCC.
What is the InChIKey of 4-ethyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene;nonane?
The InChIKey is SIGVWGDIMPRUIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14S.C9H20/c1-3-8-4-5-9-10(8)7(2)6-11-9;1-3-5-7-9-8-6-4-2/h6,8H,3-5H2,1-2H3;3-9H2,1-2H3.
What are the key properties of 4-ethyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene;nonane?
4-ethyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene;nonane has a molecular weight of 294.55 g/mol, XLogP of 7.25, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene;nonane is sourced from PubChem (CID 142603215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).