About ethene;3-ethyl-2-propylthiophene;1-methylpiperazine
ethene;3-ethyl-2-propylthiophene;1-methylpiperazine (PubChem CID 142603303) has the molecular formula C16H30N2S
and a molecular weight of 282.50 g/mol. Its IUPAC name is ethene;3-ethyl-2-propylthiophene;1-methylpiperazine.
Molecular Properties
| Compound Name | ethene;3-ethyl-2-propylthiophene;1-methylpiperazine |
| PubChem CID | 142603303 |
| Molecular Formula | C16H30N2S |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | ethene;3-ethyl-2-propylthiophene;1-methylpiperazine |
| SMILES | C=C.CCCc1sccc1CC.CN1CCNCC1 |
| InChI | InChI=1S/C9H14S.C5H12N2.C2H4/c1-3-5-9-8(4-2)6-7-10-9;1-7-4-2-6-3-5-7;1-2/h6-7H,3-5H2,1-2H3;6H,2-5H2,1H3;1-2H2 |
| InChIKey | OKPINPOGASCFQB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;3-ethyl-2-propylthiophene;1-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;3-ethyl-2-propylthiophene;1-methylpiperazine?
The IUPAC name of ethene;3-ethyl-2-propylthiophene;1-methylpiperazine (CID 142603303) is ethene;3-ethyl-2-propylthiophene;1-methylpiperazine.
What is the SMILES notation for ethene;3-ethyl-2-propylthiophene;1-methylpiperazine?
The canonical SMILES for ethene;3-ethyl-2-propylthiophene;1-methylpiperazine is C=C.CCCc1sccc1CC.CN1CCNCC1.
What is the InChIKey of ethene;3-ethyl-2-propylthiophene;1-methylpiperazine?
The InChIKey is OKPINPOGASCFQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14S.C5H12N2.C2H4/c1-3-5-9-8(4-2)6-7-10-9;1-7-4-2-6-3-5-7;1-2/h6-7H,3-5H2,1-2H3;6H,2-5H2,1H3;1-2H2.
What are the key properties of ethene;3-ethyl-2-propylthiophene;1-methylpiperazine?
ethene;3-ethyl-2-propylthiophene;1-methylpiperazine has a molecular weight of 282.50 g/mol, XLogP of 3.59, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;3-ethyl-2-propylthiophene;1-methylpiperazine is sourced from PubChem (CID 142603303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).