C10H14F3NOS — CID 142603342
2-amino-1-[2-propyl-4-(trifluoromethyl)thiophen-3-yl]ethanol (PubChem CID 142603342) has the molecular formula C10H14F3NOS and a molecular weight of 253.29 g/mol. Its IUPAC name is 2-amino-1-[2-propyl-4-(trifluoromethyl)thiophen-3-yl]ethanol.
| Compound Name | 2-amino-1-[2-propyl-4-(trifluoromethyl)thiophen-3-yl]ethanol |
|---|---|
| PubChem CID | 142603342 |
| Molecular Formula | C10H14F3NOS |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-amino-1-[2-propyl-4-(trifluoromethyl)thiophen-3-yl]ethanol |
| SMILES | CCCc1scc(C(F)(F)F)c1C(O)CN |
| InChI | InChI=1S/C10H14F3NOS/c1-2-3-8-9(7(15)4-14)6(5-16-8)10(11,12)13/h5,7,15H,2-4,14H2,1H3 |
| InChIKey | RABYIAVCXTVCBI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |