About 4-chloro-7-(3-prop-2-enylcyclopentyl)pyrrolo[2,3-d]pyrimidine;propane-2,2-diol
4-chloro-7-(3-prop-2-enylcyclopentyl)pyrrolo[2,3-d]pyrimidine;propane-2,2-diol (PubChem CID 142603388) has the molecular formula C17H24ClN3O2
and a molecular weight of 337.85 g/mol. Its IUPAC name is 4-chloro-7-(3-prop-2-enylcyclopentyl)pyrrolo[2,3-d]pyrimidine;propane-2,2-diol.
Molecular Properties
| Compound Name | 4-chloro-7-(3-prop-2-enylcyclopentyl)pyrrolo[2,3-d]pyrimidine;propane-2,2-diol |
| PubChem CID | 142603388 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 4-chloro-7-(3-prop-2-enylcyclopentyl)pyrrolo[2,3-d]pyrimidine;propane-2,2-diol |
| SMILES | C=CCC1CCC(n2ccc3c(Cl)ncnc32)C1.CC(C)(O)O |
| InChI | InChI=1S/C14H16ClN3.C3H8O2/c1-2-3-10-4-5-11(8-10)18-7-6-12-13(15)16-9-17-14(12)18;1-3(2,4)5/h2,6-7,9-11H,1,3-5,8H2;4-5H,1-2H3 |
| InChIKey | XIKLUDBCRRBLMX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-7-(3-prop-2-enylcyclopentyl)pyrrolo[2,3-d]pyrimidine;propane-2,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-7-(3-prop-2-enylcyclopentyl)pyrrolo[2,3-d]pyrimidine;propane-2,2-diol?
The IUPAC name of 4-chloro-7-(3-prop-2-enylcyclopentyl)pyrrolo[2,3-d]pyrimidine;propane-2,2-diol (CID 142603388) is 4-chloro-7-(3-prop-2-enylcyclopentyl)pyrrolo[2,3-d]pyrimidine;propane-2,2-diol.
What is the SMILES notation for 4-chloro-7-(3-prop-2-enylcyclopentyl)pyrrolo[2,3-d]pyrimidine;propane-2,2-diol?
The canonical SMILES for 4-chloro-7-(3-prop-2-enylcyclopentyl)pyrrolo[2,3-d]pyrimidine;propane-2,2-diol is C=CCC1CCC(n2ccc3c(Cl)ncnc32)C1.CC(C)(O)O.
What is the InChIKey of 4-chloro-7-(3-prop-2-enylcyclopentyl)pyrrolo[2,3-d]pyrimidine;propane-2,2-diol?
The InChIKey is XIKLUDBCRRBLMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClN3.C3H8O2/c1-2-3-10-4-5-11(8-10)18-7-6-12-13(15)16-9-17-14(12)18;1-3(2,4)5/h2,6-7,9-11H,1,3-5,8H2;4-5H,1-2H3.
What are the key properties of 4-chloro-7-(3-prop-2-enylcyclopentyl)pyrrolo[2,3-d]pyrimidine;propane-2,2-diol?
4-chloro-7-(3-prop-2-enylcyclopentyl)pyrrolo[2,3-d]pyrimidine;propane-2,2-diol has a molecular weight of 337.85 g/mol, XLogP of 3.71, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-7-(3-prop-2-enylcyclopentyl)pyrrolo[2,3-d]pyrimidine;propane-2,2-diol is sourced from PubChem (CID 142603388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).