C8H9F3N2O — CID 142603797
6-ethyl-2-(2,2,2-trifluoroethyl)pyridazin-3-one (PubChem CID 142603797) has the molecular formula C8H9F3N2O and a molecular weight of 206.17 g/mol. Its IUPAC name is 6-ethyl-2-(2,2,2-trifluoroethyl)pyridazin-3-one.
| Compound Name | 6-ethyl-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 142603797 |
| Molecular Formula | C8H9F3N2O |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 6-ethyl-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
| SMILES | CCc1ccc(=O)n(CC(F)(F)F)n1 |
| InChI | InChI=1S/C8H9F3N2O/c1-2-6-3-4-7(14)13(12-6)5-8(9,10)11/h3-4H,2,5H2,1H3 |
| InChIKey | ULEBXSUHVHBOLK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |