C22H26Cl2F3N2O3PS2 — CID 142603877
2-[3-(2,3,6-trifluoro-4-hydroxy-5-phosphanylphenyl)propyldisulfanyl]ethyl N-[4-[bis(2-chloroethyl)amino]phenyl]carbamate (PubChem CID 142603877) has the molecular formula C22H26Cl2F3N2O3PS2 and a molecular weight of 589.47 g/mol. Its IUPAC name is 2-[3-(2,3,6-trifluoro-4-hydroxy-5-phosphanylphenyl)propyldisulfanyl]ethyl N-[4-[bis(2-chloroethyl)amino]phenyl]carbamate.
| Compound Name | 2-[3-(2,3,6-trifluoro-4-hydroxy-5-phosphanylphenyl)propyldisulfanyl]ethyl N-[4-[bis(2-chloroethyl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 142603877 |
| Molecular Formula | C22H26Cl2F3N2O3PS2 |
| Molecular Weight | 589.47 g/mol |
| Exact Mass | 588.05 |
| IUPAC Name | 2-[3-(2,3,6-trifluoro-4-hydroxy-5-phosphanylphenyl)propyldisulfanyl]ethyl N-[4-[bis(2-chloroethyl)amino]phenyl]carbamate |
| SMILES | O=C(Nc1ccc(N(CCCl)CCCl)cc1)OCCSSCCCc1c(F)c(F)c(O)c(P)c1F |
| InChI | InChI=1S/C22H26Cl2F3N2O3PS2/c23-7-9-29(10-8-24)15-5-3-14(4-6-15)28-22(31)32-11-13-35-34-12-1-2-16-17(25)19(27)20(30)21(33)18(16)26/h3-6,30H,1-2,7-13,33H2,(H,28,31) |
| InChIKey | ZMORLUJHSGSZDD-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.47 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|