C30H35NO8S — CID 14260501
[(2R,3S,4R,5R,6S)-5-acetamido-4,6-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl] methanesulfonate (PubChem CID 14260501) has the molecular formula C30H35NO8S and a molecular weight of 569.68 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-acetamido-4,6-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl] methanesulfonate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-acetamido-4,6-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 14260501 |
| Molecular Formula | C30H35NO8S |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-acetamido-4,6-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-3-yl] methanesulfonate |
| SMILES | CC(=O)N[C@H]1[C@@H](OCc2ccccc2)O[C@H](COCc2ccccc2)[C@@H](OS(C)(=O)=O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H35NO8S/c1-22(32)31-27-29(36-19-24-14-8-4-9-15-24)28(39-40(2,33)34)26(21-35-18-23-12-6-3-7-13-23)38-30(27)37-20-25-16-10-5-11-17-25/h3-17,26-30H,18-21H2,1-2H3,(H,31,32)/t26-,27-,28-,29-,30+/m1/s1 |
| InChIKey | YHXDISDDUOXCMY-WYQCABFXSA-N |
| XLogP | 3.58 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|