C14H26F2O4S — CID 142605043
1,1-difluoroethyl-[(2-ethyl-2-methyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methoxy]-dimethyl-λ4-sulfane (PubChem CID 142605043) has the molecular formula C14H26F2O4S and a molecular weight of 328.42 g/mol. Its IUPAC name is 1,1-difluoroethyl-[(2-ethyl-2-methyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methoxy]-dimethyl-λ4-sulfane.
| Compound Name | 1,1-difluoroethyl-[(2-ethyl-2-methyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methoxy]-dimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 142605043 |
| Molecular Formula | C14H26F2O4S |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 1,1-difluoroethyl-[(2-ethyl-2-methyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methoxy]-dimethyl-λ4-sulfane |
| SMILES | CCC1(C)OC2CCOC(COS(C)(C)C(C)(F)F)C2O1 |
| InChI | InChI=1S/C14H26F2O4S/c1-6-13(2)19-10-7-8-17-11(12(10)20-13)9-18-21(4,5)14(3,15)16/h10-12H,6-9H2,1-5H3 |
| InChIKey | QMNHFYUPWSEYKF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |