C25H24FN8+ — CID 142605597
[(5-amino-7-fluoroimidazo[1,2-c]quinazolin-2-yl)methyl-[(Z)-2-amino-2-(4-pyridin-3-ylphenyl)ethenyl]amino]-methylazanium (PubChem CID 142605597) has the molecular formula C25H24FN8+ and a molecular weight of 455.52 g/mol. Its IUPAC name is [(5-amino-7-fluoroimidazo[1,2-c]quinazolin-2-yl)methyl-[(Z)-2-amino-2-(4-pyridin-3-ylphenyl)ethenyl]amino]-methylazanium.
| Compound Name | [(5-amino-7-fluoroimidazo[1,2-c]quinazolin-2-yl)methyl-[(Z)-2-amino-2-(4-pyridin-3-ylphenyl)ethenyl]amino]-methylazanium |
|---|---|
| PubChem CID | 142605597 |
| Molecular Formula | C25H24FN8+ |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | [(5-amino-7-fluoroimidazo[1,2-c]quinazolin-2-yl)methyl-[(Z)-2-amino-2-(4-pyridin-3-ylphenyl)ethenyl]amino]-methylazanium |
| SMILES | C[NH2+]N(/C=C(\N)c1ccc(-c2cccnc2)cc1)Cc1cn2c(N)nc3c(F)cccc3c2n1 |
| InChI | InChI=1S/C25H23FN8/c1-29-33(15-22(27)17-9-7-16(8-10-17)18-4-3-11-30-12-18)13-19-14-34-24(31-19)20-5-2-6-21(26)23(20)32-25(34)28/h2-12,14-15,29H,13,27H2,1H3,(H2,28,32)/p+1/b22-15- |
| InChIKey | MQRZXLRQUARBGU-JCMHNJIXSA-O |
| XLogP | 2.53 |
| TPSA | 114.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|