C21H36N4O4 — CID 142606221
tert-butyl N-[5-amino-5-[3-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-1,2,4-oxadiazol-5-yl]pentyl]carbamate;methanol (PubChem CID 142606221) has the molecular formula C21H36N4O4 and a molecular weight of 408.54 g/mol. Its IUPAC name is tert-butyl N-[5-amino-5-[3-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-1,2,4-oxadiazol-5-yl]pentyl]carbamate;methanol.
| Compound Name | tert-butyl N-[5-amino-5-[3-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-1,2,4-oxadiazol-5-yl]pentyl]carbamate;methanol |
|---|---|
| PubChem CID | 142606221 |
| Molecular Formula | C21H36N4O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | tert-butyl N-[5-amino-5-[3-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]-1,2,4-oxadiazol-5-yl]pentyl]carbamate;methanol |
| SMILES | C=C/C(=C\C=C/C)Cc1noc(C(N)CCCCNC(=O)OC(C)(C)C)n1.CO |
| InChI | InChI=1S/C20H32N4O3.CH4O/c1-6-8-11-15(7-2)14-17-23-18(27-24-17)16(21)12-9-10-13-22-19(25)26-20(3,4)5;1-2/h6-8,11,16H,2,9-10,12-14,21H2,1,3-5H3,(H,22,25);2H,1H3/b8-6-,15-11+; |
| InChIKey | DDYNVMQVKDQKCA-WXRGXFDOSA-N |
| XLogP | 3.60 |
| TPSA | 123.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|