C25H27N3O5 — CID 142606575
[1,1-diphenylethyl(methyl)amino] (2S)-2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]propanoate (PubChem CID 142606575) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is [1,1-diphenylethyl(methyl)amino] (2S)-2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]propanoate.
| Compound Name | [1,1-diphenylethyl(methyl)amino] (2S)-2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 142606575 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | [1,1-diphenylethyl(methyl)amino] (2S)-2-[(3-hydroxy-4-methoxypyridine-2-carbonyl)amino]propanoate |
| SMILES | COc1ccnc(C(=O)N[C@@H](C)C(=O)ON(C)C(C)(c2ccccc2)c2ccccc2)c1O |
| InChI | InChI=1S/C25H27N3O5/c1-17(27-23(30)21-22(29)20(32-4)15-16-26-21)24(31)33-28(3)25(2,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-17,29H,1-4H3,(H,27,30)/t17-/m0/s1 |
| InChIKey | HOMQKHAKORXWJC-KRWDZBQOSA-N |
| XLogP | 3.27 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|