C28H37N3O6 — CID 142606583
ethane;[[(Z,2E)-2-ethylidene-1-phenylpent-3-enyl]-methylamino] 2-[(3-acetyloxy-4-methoxypyridine-2-carbonyl)amino]propanoate (PubChem CID 142606583) has the molecular formula C28H37N3O6 and a molecular weight of 511.62 g/mol. Its IUPAC name is ethane;[[(Z,2E)-2-ethylidene-1-phenylpent-3-enyl]-methylamino] 2-[(3-acetyloxy-4-methoxypyridine-2-carbonyl)amino]propanoate.
| Compound Name | ethane;[[(Z,2E)-2-ethylidene-1-phenylpent-3-enyl]-methylamino] 2-[(3-acetyloxy-4-methoxypyridine-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 142606583 |
| Molecular Formula | C28H37N3O6 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | ethane;[[(Z,2E)-2-ethylidene-1-phenylpent-3-enyl]-methylamino] 2-[(3-acetyloxy-4-methoxypyridine-2-carbonyl)amino]propanoate |
| SMILES | C/C=C\C(=C/C)C(c1ccccc1)N(C)OC(=O)C(C)NC(=O)c1nccc(OC)c1OC(C)=O.CC |
| InChI | InChI=1S/C26H31N3O6.C2H6/c1-7-12-19(8-2)23(20-13-10-9-11-14-20)29(5)35-26(32)17(3)28-25(31)22-24(34-18(4)30)21(33-6)15-16-27-22;1-2/h7-17,23H,1-6H3,(H,28,31);1-2H3/b12-7-,19-8+; |
| InChIKey | LTMPAMLOBXJYNQ-ZJSUVLDVSA-N |
| XLogP | 4.81 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|