C11H15NS — CID 142606802
5-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methyl-1,3-thiazole (PubChem CID 142606802) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is 5-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methyl-1,3-thiazole.
| Compound Name | 5-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 142606802 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 5-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-methyl-1,3-thiazole |
| SMILES | C/C=C(\C=C/CC)c1cnc(C)s1 |
| InChI | InChI=1S/C11H15NS/c1-4-6-7-10(5-2)11-8-12-9(3)13-11/h5-8H,4H2,1-3H3/b7-6-,10-5+ |
| InChIKey | SHNATDKUBCGGPE-JQEGGOPCSA-N |
| XLogP | 3.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|