C47H31N5 — CID 142607111
1'-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3-bis(ethenyl)spiro[indene-1,11'-indolo[1,2-a]benzimidazole] (PubChem CID 142607111) has the molecular formula C47H31N5 and a molecular weight of 665.80 g/mol. Its IUPAC name is 1'-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3-bis(ethenyl)spiro[indene-1,11'-indolo[1,2-a]benzimidazole].
| Compound Name | 1'-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3-bis(ethenyl)spiro[indene-1,11'-indolo[1,2-a]benzimidazole] |
|---|---|
| PubChem CID | 142607111 |
| Molecular Formula | C47H31N5 |
| Molecular Weight | 665.80 g/mol |
| Exact Mass | 665.26 |
| IUPAC Name | 1'-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3-bis(ethenyl)spiro[indene-1,11'-indolo[1,2-a]benzimidazole] |
| SMILES | C=CC1=C(C=C)C2(c3ccccc31)c1c(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)cccc1-n1c2nc2ccccc21 |
| InChI | InChI=1S/C47H31N5/c1-3-34-36-23-11-12-25-38(36)47(37(34)4-2)42-35(24-16-28-41(42)52-40-27-14-13-26-39(40)48-46(47)52)32-21-15-22-33(29-32)45-50-43(30-17-7-5-8-18-30)49-44(51-45)31-19-9-6-10-20-31/h3-29H,1-2H2 |
| InChIKey | DRNMXPZVDDOWQC-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.80 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |