About N-methyl-N-[(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-yl]acetamide
N-methyl-N-[(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-yl]acetamide (PubChem CID 142607411) has the molecular formula C8H10F3NO2
and a molecular weight of 209.17 g/mol. Its IUPAC name is N-methyl-N-[(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-yl]acetamide.
Molecular Properties
| Compound Name | N-methyl-N-[(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-yl]acetamide |
| PubChem CID | 142607411 |
| Molecular Formula | C8H10F3NO2 |
| Molecular Weight | 209.17 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | N-methyl-N-[(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-yl]acetamide |
| SMILES | CC(=O)/C=C(\N(C)C(C)=O)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO2/c1-5(13)4-7(8(9,10)11)12(3)6(2)14/h4H,1-3H3/b7-4- |
| InChIKey | IUQWTDXMCPCWNG-DAXSKMNVSA-N |
| XLogP | 1.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.17 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-[(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-yl]acetamide?
The IUPAC name of N-methyl-N-[(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-yl]acetamide (CID 142607411) is N-methyl-N-[(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-yl]acetamide.
What is the SMILES notation for N-methyl-N-[(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-yl]acetamide?
The canonical SMILES for N-methyl-N-[(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-yl]acetamide is CC(=O)/C=C(\N(C)C(C)=O)C(F)(F)F.
What is the InChIKey of N-methyl-N-[(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-yl]acetamide?
The InChIKey is IUQWTDXMCPCWNG-DAXSKMNVSA-N. The full InChI is InChI=1S/C8H10F3NO2/c1-5(13)4-7(8(9,10)11)12(3)6(2)14/h4H,1-3H3/b7-4-.
What are the key properties of N-methyl-N-[(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-yl]acetamide?
N-methyl-N-[(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-yl]acetamide has a molecular weight of 209.17 g/mol, XLogP of 1.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-yl]acetamide is sourced from PubChem (CID 142607411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).