About N-[(Z)-2,2-difluoro-4-methyl-5-oxohex-3-en-3-yl]-N-methylacetamide
N-[(Z)-2,2-difluoro-4-methyl-5-oxohex-3-en-3-yl]-N-methylacetamide (PubChem CID 142607460) has the molecular formula C10H15F2NO2
and a molecular weight of 219.23 g/mol. Its IUPAC name is N-[(Z)-2,2-difluoro-4-methyl-5-oxohex-3-en-3-yl]-N-methylacetamide.
Molecular Properties
| Compound Name | N-[(Z)-2,2-difluoro-4-methyl-5-oxohex-3-en-3-yl]-N-methylacetamide |
| PubChem CID | 142607460 |
| Molecular Formula | C10H15F2NO2 |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | N-[(Z)-2,2-difluoro-4-methyl-5-oxohex-3-en-3-yl]-N-methylacetamide |
| SMILES | CC(=O)/C(C)=C(\N(C)C(C)=O)C(C)(F)F |
| InChI | InChI=1S/C10H15F2NO2/c1-6(7(2)14)9(10(4,11)12)13(5)8(3)15/h1-5H3/b9-6- |
| InChIKey | KNKUQQZLNHXSHC-TWGQIWQCSA-N |
| XLogP | 1.98 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-2,2-difluoro-4-methyl-5-oxohex-3-en-3-yl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-2,2-difluoro-4-methyl-5-oxohex-3-en-3-yl]-N-methylacetamide?
The IUPAC name of N-[(Z)-2,2-difluoro-4-methyl-5-oxohex-3-en-3-yl]-N-methylacetamide (CID 142607460) is N-[(Z)-2,2-difluoro-4-methyl-5-oxohex-3-en-3-yl]-N-methylacetamide.
What is the SMILES notation for N-[(Z)-2,2-difluoro-4-methyl-5-oxohex-3-en-3-yl]-N-methylacetamide?
The canonical SMILES for N-[(Z)-2,2-difluoro-4-methyl-5-oxohex-3-en-3-yl]-N-methylacetamide is CC(=O)/C(C)=C(\N(C)C(C)=O)C(C)(F)F.
What is the InChIKey of N-[(Z)-2,2-difluoro-4-methyl-5-oxohex-3-en-3-yl]-N-methylacetamide?
The InChIKey is KNKUQQZLNHXSHC-TWGQIWQCSA-N. The full InChI is InChI=1S/C10H15F2NO2/c1-6(7(2)14)9(10(4,11)12)13(5)8(3)15/h1-5H3/b9-6-.
What are the key properties of N-[(Z)-2,2-difluoro-4-methyl-5-oxohex-3-en-3-yl]-N-methylacetamide?
N-[(Z)-2,2-difluoro-4-methyl-5-oxohex-3-en-3-yl]-N-methylacetamide has a molecular weight of 219.23 g/mol, XLogP of 1.98, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-2,2-difluoro-4-methyl-5-oxohex-3-en-3-yl]-N-methylacetamide is sourced from PubChem (CID 142607460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).